edrophonium chloride

🙚 Home 🙚 Tables for Chemistry 🙘 Compound classes 🙘

edrophonium chloride
Links:🌍 Wikipedia
MeSH:Cholinergic Agents; Enzyme Inhibitors; Neurotransmitter Agents; Protective Agents
CAS RN:[116-38-1]
Formula:C10H16ClNO; 201.70 g/mol
InChiKey:BXKDSDJJOVIHMX-UHFFFAOYSA-N
SMILES:[Cl-].CC[N+](C)(C)c1cccc(O)c1
Molecular structure of edrophonium chloride
Wiswesser LN:QR CK2&1&1 &G

Isomers

edrophonium chloride
Molecular structure of edrophonium chloride
ephedrine hydrochloride
Molecular structure of ephedrine hydrochloride
(S)-α-(methoxymethyl)phenethylamine hydrochloride
Molecular structure of (S)-a-(methoxymethyl)phenethylamine hydrochloride
2-(methylamino)-1-phenylpropan-1-ol hydrochloride
Molecular structure of 2-(methylamino)-1-phenylpropan-1-ol hydrochloride
(+)-pseudoephedrine hydrochloride
Molecular structure of (+)-pseudoephedrine hydrochloride
  ::